Introduction:Basic information about CAS 4097-49-8|4-tert-Butyl-2,6-dinitrophenol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-tert-Butyl-2,6-dinitrophenol |
|---|
| CAS Number | 4097-49-8 | Molecular Weight | 240.21300 |
|---|
| Density | 1.347 g/cm3 | Boiling Point | 273.6ºC at 760 mmHg |
|---|
| Molecular Formula | C10H12N2O5 | Melting Point | 93-96°C |
|---|
| MSDS | / | Flash Point | 109.3ºC |
|---|
Names
| Name | 4-tert-Butyl-2,6-dinitrophenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.347 g/cm3 |
|---|
| Boiling Point | 273.6ºC at 760 mmHg |
|---|
| Melting Point | 93-96°C |
|---|
| Molecular Formula | C10H12N2O5 |
|---|
| Molecular Weight | 240.21300 |
|---|
| Flash Point | 109.3ºC |
|---|
| Exact Mass | 240.07500 |
|---|
| PSA | 111.87000 |
|---|
| LogP | 3.55250 |
|---|
| Index of Refraction | 1.583 |
|---|
| InChIKey | NJBDTWSOYUZQPM-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
|---|
Safety Information
| Risk Phrases | 20/21/22-36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| RIDADR | 2811 |
|---|
| Packaging Group | III |
|---|
Synonyms
| EINECS 223-856-9 |
| MFCD00051969 |
| 4-(TERT-BUTYL)-2,6-DINITROPHENOL |
| 2,6-dinitro-4-tert-butyl-phenol |
| 4-t-butyl-2,6-dinitrophenol |
| 2,6-dinitro-4-t-butyl-phenol |