Introduction:Basic information about CAS 104226-21-3|hc yellow no. 7, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | hc yellow no. 7 |
|---|
| CAS Number | 104226-21-3 | Molecular Weight | 314.38200 |
|---|
| Density | 1.2g/cm3 | Boiling Point | 578.8ºC at 760 mmHg |
|---|
| Molecular Formula | C17H22N4O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 303.8ºC |
|---|
Names
| Name | 2-[4-[(4-aminophenyl)diazenyl]-N-(2-hydroxyethyl)-3-methylanilino]ethanol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2g/cm3 |
|---|
| Boiling Point | 578.8ºC at 760 mmHg |
|---|
| Molecular Formula | C17H22N4O2 |
|---|
| Molecular Weight | 314.38200 |
|---|
| Flash Point | 303.8ºC |
|---|
| Exact Mass | 314.17400 |
|---|
| PSA | 94.44000 |
|---|
| LogP | 3.36480 |
|---|
| Vapour Pressure | 3.09E-14mmHg at 25°C |
|---|
| Index of Refraction | 1.603 |
|---|
| InChIKey | YSVKKVUAUKQDBY-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(N(CCO)CCO)ccc1N=Nc1ccc(N)cc1 |
|---|
Safety Information
Customs
| HS Code | 2927000090 |
|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| (4-Amino-phenyl)-(4-[bis-(2-hydroxy-aethyl)-amino]-2-methyl-phenyl]-diazen |
| 4'-Amino-4-[bis-(2-hydroxy-aethyl)-amino]-2-methyl-azobenzol |
| 3-methyl-4-(4'-anilino-azo)-N,N-bis(2-hydroxyethyl)aniline |
| HC Yellow 7 |
| Ethanol,2,2'-[[4-[2-(4-aminophenyl)diazenyl]-3-methylphenyl]imino]bis |
| (4-amino-phenyl)-(4-[bis-(2-hydroxy-ethyl)-amino]-2-methyl-phenyl]-diazene |
| 2,2'-({4-[(e)-(4-aminophenyl)diazenyl]-3-methylphenyl}imino)diethanol |