Introduction：Basic information about CAS 175276-66-1|5-methyl-2-(trifluoromethyl)furan-3-carbonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-methyl-2-(trifluoromethyl)furan-3-carbonyl chloride |
|---|
| CAS Number | 175276-66-1 | Molecular Weight | 212.55400 |
|---|
| Density | 1.432g/cm3 | Boiling Point | 225.3ºC at 760mmHg |
|---|
| Molecular Formula | C7H4ClF3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 90.1ºC |
|---|
Names
| Name | 5-methyl-2-(trifluoromethyl)furan-3-carbonyl chloride |
|---|
Chemical & Physical Properties
| Density | 1.432g/cm3 |
|---|
| Boiling Point | 225.3ºC at 760mmHg |
|---|
| Molecular Formula | C7H4ClF3O2 |
|---|
| Molecular Weight | 212.55400 |
|---|
| Flash Point | 90.1ºC |
|---|
| Exact Mass | 211.98500 |
|---|
| PSA | 30.21000 |
|---|
| LogP | 2.98580 |
|---|
| Vapour Pressure | 0.0868mmHg at 25°C |
|---|
| Index of Refraction | 1.433 |
|---|
| InChIKey | YJUNYUKKNWEHBQ-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(C(=O)Cl)c(C(F)(F)F)o1 |
|---|
Safety Information
| Hazard Codes | C: Corrosive; |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
| RIDADR | UN 3265 |
|---|
