Introduction:Basic information about CAS 66266-36-2|Naphthalimide, 3-nitro-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Naphthalimide, 3-nitro- |
|---|
| CAS Number | 66266-36-2 | Molecular Weight | 242.18700 |
|---|
| Density | 1.577g/cm3 | Boiling Point | 540.4ºC at 760 mmHg |
|---|
| Molecular Formula | C12H6N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 280.6ºC |
|---|
Names
| Name | 5-nitrobenzo[de]isoquinoline-1,3-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.577g/cm3 |
|---|
| Boiling Point | 540.4ºC at 760 mmHg |
|---|
| Molecular Formula | C12H6N2O4 |
|---|
| Molecular Weight | 242.18700 |
|---|
| Flash Point | 280.6ºC |
|---|
| Exact Mass | 242.03300 |
|---|
| PSA | 95.75000 |
|---|
| LogP | 1.91070 |
|---|
| Index of Refraction | 1.738 |
|---|
| InChIKey | CWVQFVQNUBOYEE-UHFFFAOYSA-N |
|---|
| SMILES | O=C1NC(=O)c2cc([N+](=O)[O-])cc3cccc1c23 |
|---|
Synonyms
| 3-nitro-1,8-naphthalimide |
| Naphthalimide,3-nitro |
| 5-nitronaphthalimide |