Introduction：Basic information about CAS 562098-08-2|4-(Acetoxymethyl)benzeneboronic acid pinacol ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(Acetoxymethyl)benzeneboronic acid pinacol ester |
|---|
| CAS Number | 562098-08-2 | Molecular Weight | 276.13600 |
|---|
| Density | 1.07g/cm3 | Boiling Point | 360.7ºC at 760 mmHg |
|---|
| Molecular Formula | C15H21BO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 171.9ºC |
|---|
Names
| Name | [4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl acetate |
|---|
Chemical & Physical Properties
| Density | 1.07g/cm3 |
|---|
| Boiling Point | 360.7ºC at 760 mmHg |
|---|
| Molecular Formula | C15H21BO4 |
|---|
| Molecular Weight | 276.13600 |
|---|
| Flash Point | 171.9ºC |
|---|
| Exact Mass | 276.15300 |
|---|
| PSA | 44.76000 |
|---|
| LogP | 2.04890 |
|---|
| Index of Refraction | 1.497 |
|---|
| InChIKey | CINSSLPYZWYFSB-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)OCc1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
|---|
