CAS 37002-48-5|(+)-diop
Introduction：Basic information about CAS 37002-48-5|(+)-diop, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (+)-diop | ||
|---|---|---|---|
| CAS Number | 37002-48-5 | Molecular Weight | 498.53200 |
| Density | / | Boiling Point | 590.3ºC at 760 mmHg |
| Molecular Formula | C31H32O2P2 | Melting Point | 88 - 90ºC |
| MSDS | ChineseUSA | Flash Point | 390.9ºC |
| Symbol | GHS07 | Signal Word | Warning |
Names
| Name | [(4S,5S)-5-(diphenylphosphanylmethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl-diphenylphosphane |
|---|---|
| Synonym | More Synonyms |
Chemical & Physical Properties
| Boiling Point | 590.3ºC at 760 mmHg |
|---|---|
| Melting Point | 88 - 90ºC |
| Molecular Formula | C31H32O2P2 |
| Molecular Weight | 498.53200 |
| Flash Point | 390.9ºC |
| Exact Mass | 498.18800 |
| PSA | 45.64000 |
| LogP | 5.77230 |
| InChIKey | VCHDBLPQYJAQSQ-LOYHVIPDSA-N |
| SMILES | CC1(C)OC(CP(c2ccccc2)c2ccccc2)C(CP(c2ccccc2)c2ccccc2)O1 |
Safety Information
| Symbol | GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 29319090 |
Articles5
More Articles| Morimoto, T. et al. Tetrahedron Asymmetry 6 , 23, (1995) | |
| Morimoto, T. at al. Tetrahedron Asymmetry 6 , 75, (1995) | |
| Matsumoto, Y. et al. Tetrahedron 50 , 335, (1994) |
Synonyms
| (+)-(S,S)-2,3-O-isopropylidene-2,3-dihydroxy-1,4-bis(diphenylphosphinobutane) |
| (S)-4-AMINO-3-HYDROXYBUTANOIC ACID |
| ((anti-2,2-dimethyl-1,3-dioxolane-4,5-diyl)bis(methylene))bis(diphenylphosphine) |
| (S,S)-1,4-bis(diphenylphosphino)-1,4-dideoxy-2,3-O-isopropylidene-L-threitol |
| (4S,5S)-(+)-Bis(diphenylphosphinomethyl)-2,2-dimethyl-1,3-dioxolane |
| (S)-(+)-GABOB |
| (+)-2,3-O,O'-isopropylidene-2,3-dihydroxy-1,4-bis(diphenylphosphanyl)butane |
| acide (S)-amino-4 hydroxy-3 butanoique |
| (2S,3S)-(+)-1,4-Bis(diphenylphosphino)-2,3-O-isopropylidene-2,3-butanediol |
| (+)-2,3-O-Isopropylidene-2,3-dihydroxy-1,4-bis(diphenylphosphino)butane |
| (S)-(+)-Amino-3-hydroxybutanoic acid |
| EINECS 253-307-9 |
| (2S,3S)-(+)-2,3-O-Isopropylidene-2,3-dihydroxy-1,4-bis(diphenylphosphino)butane |
| (S)-(+)-4-Amino-3-hydroxybutyric acid |
| (((4S,5S)-2,2-Dimethyl-1,3-dioxolane-4,5-diyl)bis(methylene))bis(diphenylphosphine) |
| MFCD00009760 |
| (4S,5S)-(+)-4,5-Bis(diphenylphosphinomethyl)-2,2-dimethyl-1,3-dioxolane |
| (+)-2,3-O-Isopropylidene-2,3-dihydroxy-1,4-bis(diphenylphosphino) |
