Introduction：Basic information about CAS 1732-96-3|1,2,4-Benzenetricarboxylic acid 1,2-anhydride ethylene ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,2,4-Benzenetricarboxylic acid 1,2-anhydride ethylene ester |
|---|
| CAS Number | 1732-96-3 | Molecular Weight | 410.28700 |
|---|
| Density | 1.625g/cm3 | Boiling Point | 681.8ºC at 760mmHg |
|---|
| Molecular Formula | C20H10O10 | Melting Point | 167-169ºC |
|---|
| MSDS | / | Flash Point | 299.1ºC |
|---|
Names
| Name | Ethane-1,2-diyl bis(1,3-dioxo-1,3-dihydroisobenzofuran-5-carboxylate) |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.625g/cm3 |
|---|
| Boiling Point | 681.8ºC at 760mmHg |
|---|
| Melting Point | 167-169ºC |
|---|
| Molecular Formula | C20H10O10 |
|---|
| Molecular Weight | 410.28700 |
|---|
| Flash Point | 299.1ºC |
|---|
| Exact Mass | 410.02700 |
|---|
| PSA | 139.34000 |
|---|
| LogP | 1.32160 |
|---|
| Vapour Pressure | 1.92E-18mmHg at 25°C |
|---|
| Index of Refraction | 1.657 |
|---|
| InChIKey | XQBLBHYWXZNCJZ-UHFFFAOYSA-N |
|---|
| SMILES | O=C(OCCOC(=O)c1ccc2c(c1)C(=O)OC2=O)c1ccc2c(c1)C(=O)OC2=O |
|---|
Synonyms
| 2-(1,3-dioxo-2-benzofuran-5-carbonyl)oxyethyl 1,3-dioxo-2-benzofuran-5-carboxylate |
