Introduction：Basic information about CAS 569-37-9|Benzenepropanoic acid, a-acetyl-b-oxo-, ethyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzenepropanoic acid, a-acetyl-b-oxo-, ethyl ester |
|---|
| CAS Number | 569-37-9 | Molecular Weight | 234.24800 |
|---|
| Density | 1.145g/cm3 | Boiling Point | 325.3ºC at 760 mmHg |
|---|
| Molecular Formula | C13H14O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 141.1ºC |
|---|
Names
| Name | ethyl 2-benzoyl-3-oxobutanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.145g/cm3 |
|---|
| Boiling Point | 325.3ºC at 760 mmHg |
|---|
| Molecular Formula | C13H14O4 |
|---|
| Molecular Weight | 234.24800 |
|---|
| Flash Point | 141.1ºC |
|---|
| Exact Mass | 234.08900 |
|---|
| PSA | 60.44000 |
|---|
| LogP | 1.63760 |
|---|
| Index of Refraction | 1.51 |
|---|
| InChIKey | CMJWTVYVMCEPGG-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)C(C(C)=O)C(=O)c1ccccc1 |
|---|
Synonyms
| 1-phenyl-2-ethoxycarbonylbutane-1,3-dione |
| ethyl 3-oxo-2-benzoylbutanoate |
| Ethyl 2-benzoylacetoacetate |
| 2-Benzoyl-3-oxo-buttersaeure-aethylester |
| 2-carbethoxy-1-phenylbutane-1,3-dione |
| 2-benzoyl-3-oxo-butyric acid ethyl ester |
| EINECS 209-313-9 |
| Benzoylacetessigester |
