Introduction：Basic information about CAS 69677-02-7|N2,N6-Bis[(benzyloxy)carbonyl]lysine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N2,N6-Bis[(benzyloxy)carbonyl]lysine |
|---|
| CAS Number | 69677-02-7 | Molecular Weight | 414.452 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 659.0±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C22H26N2O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 352.4±31.5 °C |
|---|
Names
| Name | (2R)-2,6-bis(phenylmethoxycarbonylamino)hexanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 659.0±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C22H26N2O6 |
|---|
| Molecular Weight | 414.452 |
|---|
| Flash Point | 352.4±31.5 °C |
|---|
| Exact Mass | 414.179077 |
|---|
| PSA | 113.96000 |
|---|
| LogP | 3.75 |
|---|
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.569 |
|---|
| InChIKey | BLZXFNUZFTZCFD-LJQANCHMSA-N |
|---|
| SMILES | O=C(NCCCCC(NC(=O)OCc1ccccc1)C(=O)O)OCc1ccccc1 |
|---|
| Storage condition | Store at RT. |
|---|
Synonyms
| N2,N6-Bis-Cbz-D-lysine |
| N,N-Bis[(benzyloxy)carbonyl]lysine |
| D-lysine, N,N-bis[(phenylmethoxy)carbonyl]- |
| N,N-Bis[(benzyloxy)carbonyl]-D-lysin |
| FC0804 |
| (R)-2,6-Bis(((benzyloxy)carbonyl)amino)hexanoic acid |
| N,N-bis[(benzyloxy)carbonyl]-D-lysine |
| N,N'-bis-benzyloxycarbonyl-R(+)-lysine |
| Lysine, N,N-bis[(phenylmethoxy)carbonyl]- |
| N,N'-Dibenzyloxycarbonyl-D-lysine |
| Z-D-Lys(Z)-OH |
