Introduction：Basic information about CAS 621-14-7|Butanedioic acid,1,4-diphenyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Butanedioic acid,1,4-diphenyl ester |
|---|
| CAS Number | 621-14-7 | Molecular Weight | 270.28000 |
|---|
| Density | 1.198g/cm3 | Boiling Point | 418.1ºC at760mmHg |
|---|
| Molecular Formula | C16H14O4 | Melting Point | 121ºC |
|---|
| MSDS | / | Flash Point | 211.6ºC |
|---|
Names
| Name | diphenyl butanedioate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.198g/cm3 |
|---|
| Boiling Point | 418.1ºC at760mmHg |
|---|
| Melting Point | 121ºC |
|---|
| Molecular Formula | C16H14O4 |
|---|
| Molecular Weight | 270.28000 |
|---|
| Flash Point | 211.6ºC |
|---|
| Exact Mass | 270.08900 |
|---|
| PSA | 52.60000 |
|---|
| LogP | 2.97780 |
|---|
| Index of Refraction | 1.561 |
|---|
| InChIKey | YDPPRPIIZGLGCJ-UHFFFAOYSA-N |
|---|
| SMILES | O=C(CCC(=O)Oc1ccccc1)Oc1ccccc1 |
|---|
Safety Information
Customs
| HS Code | 2917190090 |
|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| benzylsuccinate |
| AC1Q61LZ |
| Diphenyl-succinat |
| Diphenyl succinate |
| butanedioic acid,diphenyl ester |
| Bernsteinsaeure-diphenylester |
| AC1L2BK5 |
| succinic acid diphenyl ester |
| CTK5B4364 |
