Introduction：Basic information about CAS 1001070-50-3|5-methyl-1-(phenylsulfonyl)-1H-Pyrrolo[2,3-b]pyridine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-methyl-1-(phenylsulfonyl)-1H-Pyrrolo[2,3-b]pyridine |
|---|
| CAS Number | 1001070-50-3 | Molecular Weight | 272.322 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 477.2±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H12N2O2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 242.4±26.5 °C |
|---|
Names
| Name | 1-(benzenesulfonyl)-5-methylpyrrolo[2,3-b]pyridine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 477.2±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H12N2O2S |
|---|
| Molecular Weight | 272.322 |
|---|
| Flash Point | 242.4±26.5 °C |
|---|
| Exact Mass | 272.061951 |
|---|
| PSA | 60.34000 |
|---|
| LogP | 2.81 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.654 |
|---|
| InChIKey | BYOCVLCQUZBHNT-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cnc2c(ccn2S(=O)(=O)c2ccccc2)c1 |
|---|
Synonyms
| 1H-PYRROLO[2,3-B]PYRIDINE,5-METHYL-1-(PHENYLSULFONYL) |
| 5-Methyl-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine |
| 1-(Phenylsulphonyl)-5-methyl-7-azaindole |
| 1-benzenesulfonyl-5-methyl-1H-pyrrolo[2,3-b]pyridine |
| 1H-Pyrrolo[2,3-b]pyridine, 5-methyl-1-(phenylsulfonyl)- |
