Introduction：Basic information about CAS 2961-04-8|9,10-Anthracenedione,1,4,5-trihydroxy-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 9,10-Anthracenedione,1,4,5-trihydroxy- |
|---|
| CAS Number | 2961-04-8 | Molecular Weight | 256.21000 |
|---|
| Density | 1.659g/cm3 | Boiling Point | 503.4ºC at 760mmHg |
|---|
| Molecular Formula | C14H8O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 272.3ºC |
|---|
Names
| Name | 1,4,5-trihydroxyanthraquinone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.659g/cm3 |
|---|
| Boiling Point | 503.4ºC at 760mmHg |
|---|
| Molecular Formula | C14H8O5 |
|---|
| Molecular Weight | 256.21000 |
|---|
| Flash Point | 272.3ºC |
|---|
| Exact Mass | 256.03700 |
|---|
| PSA | 94.83000 |
|---|
| LogP | 1.57880 |
|---|
| Vapour Pressure | 9.35E-11mmHg at 25°C |
|---|
| Index of Refraction | 1.772 |
|---|
| InChIKey | PRKNCOCERFKSLP-UHFFFAOYSA-N |
|---|
| SMILES | O=C1c2cccc(O)c2C(=O)c2c(O)ccc(O)c21 |
|---|
Safety Information
Customs
| HS Code | 2914690090 |
|---|
| Summary | 2914690090 other quinones。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| 1,4,5-trihydroxy-9,10-anthraquinone |
| 1,4,5-Trihydroxy-9,10-anthrachinon |
| 1,4,5-trihydroxyanthracene-9,10-dione |
| Anthraquinone,1,4,5-trihydroxy |
| 1,4,5-trihydroxyanthraquibone |
| 1,5-Trihydroxyanthraquinone |
| 5-hydroxyquinizarin |
| 5-hydroxyquinizarine |
