Introduction：Basic information about CAS 17856-92-7|nitronium hexafluoroantimonate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | nitronium hexafluoroantimonate |
|---|
| CAS Number | 17856-92-7 | Molecular Weight | 281.75600 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | F6NO2Sb | Melting Point | / |
|---|
| MSDS | USA | Flash Point | / |
|---|
| Symbol |
GHS07, GHS09 | Signal Word | Warning |
|---|
Names
| Name | nitronium,hexafluoroantimony(1-) |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | F6NO2Sb |
|---|
| Molecular Weight | 281.75600 |
|---|
| Exact Mass | 280.88700 |
|---|
| PSA | 34.14000 |
|---|
| LogP | 2.10760 |
|---|
| InChIKey | OFNJLTRMKNMFSW-UHFFFAOYSA-H |
|---|
| SMILES | F[Sb-](F)(F)(F)(F)F.O=[N+]=O |
|---|
| Storage condition | 0-6°C |
|---|
| Stability | Stable, but moisture sensitive. Incompatible with strong oxidizing agents. |
|---|
Safety Information
| Symbol |
GHS07, GHS09 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302-H332-H411 |
|---|
| Precautionary Statements | P273 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xn,N,C:Corrosive/Hygroscopic; |
|---|
| Risk Phrases | R20/22 |
|---|
| Safety Phrases | S61 |
|---|
| RIDADR | UN 3260 8/PG 2 |
|---|
| WGK Germany | 2 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 6.1 |
|---|
Synonyms
| Nitryl hexafluoroantimonate |
| nitronium hexafluorostiboranuide |
| MFCD00042551 |
| Dioxoammonium hexafluoroantimonate(1-) |
| Nitronium hexafluoroantimonate |
| nitronium hexakis(fluoranyl)antimony(1-) |
| Nitronium hexafluoroantimonate(V) |
| PC5258 |
