Introduction：Basic information about CAS 175137-66-3|4-(4-chlorophenyl)sulfonyl-3-methylthiophene-2-carbonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(4-chlorophenyl)sulfonyl-3-methylthiophene-2-carbonyl chloride |
|---|
| CAS Number | 175137-66-3 | Molecular Weight | 335.22600 |
|---|
| Density | 1.51g/cm3 | Boiling Point | 501.4ºC at 760mmHg |
|---|
| Molecular Formula | C12H8Cl2O3S2 | Melting Point | 131ºC |
|---|
| MSDS | / | Flash Point | 257ºC |
|---|
Names
| Name | 4-(4-chlorophenyl)sulfonyl-3-methylthiophene-2-carbonyl chloride |
|---|
Chemical & Physical Properties
| Density | 1.51g/cm3 |
|---|
| Boiling Point | 501.4ºC at 760mmHg |
|---|
| Melting Point | 131ºC |
|---|
| Molecular Formula | C12H8Cl2O3S2 |
|---|
| Molecular Weight | 335.22600 |
|---|
| Flash Point | 257ºC |
|---|
| Exact Mass | 333.92900 |
|---|
| PSA | 87.83000 |
|---|
| LogP | 5.00250 |
|---|
| Vapour Pressure | 3.49E-10mmHg at 25°C |
|---|
| Index of Refraction | 1.615 |
|---|
| InChIKey | JOAKJQHALCTWCT-UHFFFAOYSA-N |
|---|
| SMILES | Cc1c(S(=O)(=O)c2ccc(Cl)cc2)csc1C(=O)Cl |
|---|
