Introduction:Basic information about CAS 375-00-8|heptafluorobutyronitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | heptafluorobutyronitrile |
|---|
| CAS Number | 375-00-8 | Molecular Weight | 195.03800 |
|---|
| Density | 1.545 g/cm3 | Boiling Point | 18.8ºC at 760 mmHg |
|---|
| Molecular Formula | C4F7N | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2,2,3,3,4,4,4-heptafluorobutanenitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.545 g/cm3 |
|---|
| Boiling Point | 18.8ºC at 760 mmHg |
|---|
| Molecular Formula | C4F7N |
|---|
| Molecular Weight | 195.03800 |
|---|
| Exact Mass | 194.99200 |
|---|
| PSA | 23.79000 |
|---|
| LogP | 2.34288 |
|---|
| Index of Refraction | 1.271 |
|---|
| InChIKey | BOZRBIJGLJJPRF-UHFFFAOYSA-N |
|---|
| SMILES | N#CC(F)(F)C(F)(F)C(F)(F)F |
|---|
Safety Information
| Hazard Codes | T: Toxic; |
|---|
| Risk Phrases | 20/21/22-36/37/38 |
|---|
| Safety Phrases | 36/37/39-45 |
|---|
| RIDADR | UN 3162 |
|---|
| HS Code | 2926909090 |
|---|
Customs
| HS Code | 2926909090 |
|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| heptafluorobutanenitrile |
| Butanenitrile,heptafluoro |
| Heptafluor-butyronitril |
| Perfluorbuttersaeure-nitril |
| MFCD00039480 |
| heptafluoropropyl nitrile |
| heptafluoro-butyronitrile |
| EINECS 206-781-6 |
| perfluoropropyl cyanide |
| heptafluoropropyl cyanide |