Introduction：Basic information about CAS 17201-83-1|1-(Chloromethyl)-1,1,3,3,3-pentamethyldisiloxane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(Chloromethyl)-1,1,3,3,3-pentamethyldisiloxane |
|---|
| CAS Number | 17201-83-1 | Molecular Weight | 196.823 |
|---|
| Density | 0.9±0.1 g/cm3 | Boiling Point | 147.3±13.0 °C at 760 mmHg |
|---|
| Molecular Formula | C6H17ClOSi2 | Melting Point | <0°C |
|---|
| MSDS | / | Flash Point | 37.6±12.0 °C |
|---|
Names
| Name | chloromethylpentamethyldisiloxane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.9±0.1 g/cm3 |
|---|
| Boiling Point | 147.3±13.0 °C at 760 mmHg |
|---|
| Melting Point | <0°C |
|---|
| Molecular Formula | C6H17ClOSi2 |
|---|
| Molecular Weight | 196.823 |
|---|
| Flash Point | 37.6±12.0 °C |
|---|
| Exact Mass | 196.050644 |
|---|
| PSA | 9.23000 |
|---|
| LogP | 4.44 |
|---|
| Vapour Pressure | 5.6±0.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.411 |
|---|
| InChIKey | OBSWSTDGLWZVEI-UHFFFAOYSA-N |
|---|
| SMILES | C[Si](C)(C)O[Si](C)(C)CCl |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | 11 |
|---|
| Safety Phrases | 16-26-36/37/39 |
|---|
| RIDADR | 1993 |
|---|
| HS Code | 2934999090 |
|---|
Customs
| HS Code | 2934999090 |
|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| chloromethylpentadisiloxane |
| Disiloxane, 1-(chloromethyl)-1,1,3,3,3-pentamethyl- |
| ClCH2SiMe2OSiMe3 |
| 1-Chloromethyl-1,1,3,3,3-pentamethylpropanedisiloxane |
| 1-(Chloromethyl)-1,1,3,3,3-pentamethyldisiloxane |
| chloromethyl-pentamethyl-disiloxane |
| Chlormethyl-pentamethyl-disiloxan |
| 1-chloromethylpentamethyldisiloxane |
| 1-Chlor-2.2.4.4-tetramethyl-3-oxa-2.4-disila-pentan |
| Chloromethyl Pentamethyl Disiloxane |
