Introduction：Basic information about CAS 2401-73-2|1,3-Dichloro-1,1,3,3-tetramethyldisiloxane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,3-Dichloro-1,1,3,3-tetramethyldisiloxane |
|---|
| CAS Number | 2401-73-2 | Molecular Weight | 203.214 |
|---|
| Density | 1.0±0.1 g/cm3 | Boiling Point | 138.0±9.0 °C at 760 mmHg |
|---|
| Molecular Formula | C4H12Cl2OSi2 | Melting Point | -37 °C |
|---|
| MSDS | ChineseUSA | Flash Point | 33.0±10.8 °C |
|---|
| Symbol |
GHS02, GHS05 | Signal Word | Danger |
|---|
Names
| Name | chloro-[chloro(dimethyl)silyl]oxy-dimethylsilane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.0±0.1 g/cm3 |
|---|
| Boiling Point | 138.0±9.0 °C at 760 mmHg |
|---|
| Melting Point | -37 °C |
|---|
| Molecular Formula | C4H12Cl2OSi2 |
|---|
| Molecular Weight | 203.214 |
|---|
| Flash Point | 33.0±10.8 °C |
|---|
| Exact Mass | 201.980377 |
|---|
| PSA | 9.23000 |
|---|
| LogP | 4.97 |
|---|
| Vapour Pressure | 8.5±0.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.421 |
|---|
| InChIKey | DMEXFOUCEOWRGD-UHFFFAOYSA-N |
|---|
| SMILES | C[Si](C)(Cl)O[Si](C)(C)Cl |
|---|
| Storage condition | Flammables area |
|---|
Safety Information
| Symbol |
GHS02, GHS05 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H225-H314 |
|---|
| Precautionary Statements | P210-P280-P305 + P351 + P338-P310 |
|---|
| Personal Protective Equipment | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
|---|
| Hazard Codes | F: Flammable;C: Corrosive; |
|---|
| Risk Phrases | R11 |
|---|
| Safety Phrases | S16-S26-S27-S36/37/39-S45 |
|---|
| RIDADR | UN 2985 3/PG 2 |
|---|
| WGK Germany | 3 |
|---|
| Packaging Group | II |
|---|
| Hazard Class | 3 |
|---|
| HS Code | 2934999090 |
|---|
Customs
| HS Code | 2934999090 |
|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| Disiloxane,1,3-dichloro-1,1,3,3-tetramethyl |
| DMEXFOUCEOWRGD-UHFFFAOYSA |
| 1,3-dichloro-tetramethyldisiloxane |
| 1,3-DICHLOROTETRAMETHYLDISILOXANE |
| MFCD00018088 |
| EINECS 219-278-1 |
| 1,1,3,3-tetramethyl-1,3-dichlorodisiloxane |
| 1,1,3,3,-tetramethyl-1,3-dichlorosiloxane |
| 1,3-Dichloro-1,1,3,3-tetramethyldisiloxane |
| 1,1'-dichloro tetramethyl disiloxane |
| Disiloxane, 1,3-dichloro-1,1,3,3-tetramethyl- |
| 1,3-Dichloro-1,1,3,3-Tetramethyl Disiloxane |
