Introduction:Basic information about CAS 889949-41-1|[2-(1-amino-ethyl)-phenyl]-carbamic acid tert-butyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | [2-(1-amino-ethyl)-phenyl]-carbamic acid tert-butyl ester |
|---|
| CAS Number | 889949-41-1 | Molecular Weight | 236.31000 |
|---|
| Density | 1.095g/cm3 | Boiling Point | 306ºC at 760 mmHg |
|---|
| Molecular Formula | C13H20N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 138.8ºC |
|---|
Names
| Name | [2-(1-amino-ethyl)-phenyl]-carbamic acid tert-butyl ester |
|---|
Chemical & Physical Properties
| Density | 1.095g/cm3 |
|---|
| Boiling Point | 306ºC at 760 mmHg |
|---|
| Molecular Formula | C13H20N2O2 |
|---|
| Molecular Weight | 236.31000 |
|---|
| Flash Point | 138.8ºC |
|---|
| Exact Mass | 236.15200 |
|---|
| PSA | 64.35000 |
|---|
| LogP | 3.82660 |
|---|
| Index of Refraction | 1.554 |
|---|
| InChIKey | ZMCJMXOMUPBVOP-UHFFFAOYSA-N |
|---|
| SMILES | CC(N)c1ccccc1NC(=O)OC(C)(C)C |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|