Introduction:Basic information about CAS 17401-15-9|(2-Methyl-4-phenylquinolin-3-yl)acetic acid hydrochloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (2-Methyl-4-phenylquinolin-3-yl)acetic acid hydrochloride |
|---|
| CAS Number | 17401-15-9 | Molecular Weight | 313.77800 |
|---|
| Density | 1.228g/cm3 | Boiling Point | 470.6ºC at 760mmHg |
|---|
| Molecular Formula | C18H16ClNO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 238.4ºC |
|---|
Names
| Name | 2-(2-methyl-4-phenylquinolin-3-yl)acetic acid,hydrochloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.228g/cm3 |
|---|
| Boiling Point | 470.6ºC at 760mmHg |
|---|
| Molecular Formula | C18H16ClNO2 |
|---|
| Molecular Weight | 313.77800 |
|---|
| Flash Point | 238.4ºC |
|---|
| Exact Mass | 313.08700 |
|---|
| PSA | 50.19000 |
|---|
| LogP | 4.63930 |
|---|
| Vapour Pressure | 1.17E-09mmHg at 25°C |
|---|
| InChIKey | FSRDDXOKSKFDFO-UHFFFAOYSA-N |
|---|
| SMILES | Cc1nc2ccccc2c(-c2ccccc2)c1CC(=O)O.Cl |
|---|
Safety Information
Customs
| HS Code | 2933499090 |
|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 2-(2-Methyl-4-phenylquinolin-3-yl)acetic acid hydrochloride |
| MFCD08445256 |
| (2-methyl-4-phenyl-quinolin-3-yl)-acetic acid |
| (2-methyl-4-phenylquinolin-3-yl)acetic acid hydrochloride |
| 2-Methyl-4-phenyl-3-carboxymethyl-chinolin |