Introduction：Basic information about CAS 17123-30-7|H-Gly-Phe-Ala-OH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | H-Gly-Phe-Ala-OH |
|---|
| CAS Number | 17123-30-7 | Molecular Weight | 293.31800 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C14H19N3O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2-[[2-[(2-aminoacetyl)amino]-3-phenylpropanoyl]amino]propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C14H19N3O4 |
|---|
| Molecular Weight | 293.31800 |
|---|
| Exact Mass | 293.13800 |
|---|
| PSA | 121.52000 |
|---|
| LogP | 0.74400 |
|---|
| InChIKey | WMGHDYWNHNLGBV-UHFFFAOYSA-N |
|---|
| SMILES | CC(NC(=O)C(Cc1ccccc1)NC(=O)CN)C(=O)O |
|---|
Safety Information
| WGK Germany | 3 |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| glycyl-phenylalanyl-alanine |
| Glycyl-L-phenylalanyl-L-alanin |
| Gly-Phe-Ala |
| glycyl=>L-phenylalanyl=>L-alanine |
