Introduction:Basic information about CAS 103539-61-3|(R)-2-methyl-1-((s)-1-phenylethyl)piperidin-4-one, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (R)-2-methyl-1-((s)-1-phenylethyl)piperidin-4-one |
|---|
| CAS Number | 103539-61-3 | Molecular Weight | 217.30700 |
|---|
| Density | 1.037 g/cm3 | Boiling Point | 319.118ºC at 760 mmHg |
|---|
| Molecular Formula | C14H19NO | Melting Point | / |
|---|
| MSDS | / | Flash Point | 137.366ºC |
|---|
Names
| Name | (R)-2-methyl-1-((s)-1-phenylethyl)piperidin-4-one |
|---|
Chemical & Physical Properties
| Density | 1.037 g/cm3 |
|---|
| Boiling Point | 319.118ºC at 760 mmHg |
|---|
| Molecular Formula | C14H19NO |
|---|
| Molecular Weight | 217.30700 |
|---|
| Flash Point | 137.366ºC |
|---|
| Exact Mass | 217.14700 |
|---|
| PSA | 20.31000 |
|---|
| LogP | 2.73890 |
|---|
| Index of Refraction | 1.535 |
|---|
| InChIKey | XOGIRAQPVLKDBV-NWDGAFQWSA-N |
|---|
| SMILES | CC1CC(=O)CCN1C(C)c1ccccc1 |
|---|