Introduction:Basic information about CAS 72822-03-8|Pergolide Sulfone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Pergolide Sulfone |
|---|
| CAS Number | 72822-03-8 | Molecular Weight | 346.48700 |
|---|
| Density | 1.208g/cm3 | Boiling Point | 583.3ºC at 760 mmHg |
|---|
| Molecular Formula | C19H26N2O2S | Melting Point | 190-193ºC |
|---|
| MSDS | / | Flash Point | 306.6ºC |
|---|
Names
Chemical & Physical Properties
| Density | 1.208g/cm3 |
|---|
| Boiling Point | 583.3ºC at 760 mmHg |
|---|
| Melting Point | 190-193ºC |
|---|
| Molecular Formula | C19H26N2O2S |
|---|
| Molecular Weight | 346.48700 |
|---|
| Flash Point | 306.6ºC |
|---|
| Exact Mass | 346.17100 |
|---|
| PSA | 61.55000 |
|---|
| LogP | 3.97140 |
|---|
| Index of Refraction | 1.597 |
|---|
| InChIKey | BRFHHAXHZFOBNY-DQYPLQBXSA-N |
|---|
| SMILES | CCCN1CC(CS(C)(=O)=O)CC2c3cccc4[nH]cc(c34)CC21 |
|---|