Introduction：Basic information about CAS 50343-81-2|3,5-Dichloro-2-hydroxy-4-(trifluoromethyl)benzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,5-Dichloro-2-hydroxy-4-(trifluoromethyl)benzoic acid |
|---|
| CAS Number | 50343-81-2 | Molecular Weight | 275.00900 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C8H3Cl2F3O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 3,5-Dichloro-2-hydroxy-4-(trifluoromethyl)benzoic acid |
|---|
Chemical & Physical Properties
| Molecular Formula | C8H3Cl2F3O3 |
|---|
| Molecular Weight | 275.00900 |
|---|
| Exact Mass | 273.94100 |
|---|
| PSA | 57.53000 |
|---|
| LogP | 3.41600 |
|---|
| InChIKey | KIXHBEIZHMJMFR-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cc(Cl)c(C(F)(F)F)c(Cl)c1O |
|---|
Safety Information
Customs
| HS Code | 2918290000 |
|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
|---|
