Introduction：Basic information about CAS 562-73-2|Hexahydro-1,3,4,5-tetrahydroxybenzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Hexahydro-1,3,4,5-tetrahydroxybenzoic acid |
|---|
| CAS Number | 562-73-2 | Molecular Weight | 192.16700 |
|---|
| Density | 1.828g/cm3 | Boiling Point | 438.4ºC at 760 mmHg |
|---|
| Molecular Formula | C7H12O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 233.1ºC |
|---|
Names
| Name | 1,3,4,5-Tetrahydroxycyclohexanecarboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.828g/cm3 |
|---|
| Boiling Point | 438.4ºC at 760 mmHg |
|---|
| Molecular Formula | C7H12O6 |
|---|
| Molecular Weight | 192.16700 |
|---|
| Flash Point | 233.1ºC |
|---|
| Exact Mass | 192.06300 |
|---|
| PSA | 118.22000 |
|---|
| Index of Refraction | 1.687 |
|---|
| InChIKey | AAWZDTNXLSGCEK-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)C1(O)CC(O)C(O)C(O)C1 |
|---|
Synonyms
| Cordycepinsaeure |
| 1,3,4,5-Tetrahydroxycyclohexane-1-carboxylic acid |
| Chinasaeure |
| 1,3,4,5-tetrahydroxy-cyclohexanecarboxylic acid |
| 1,3,4,5-Tetrahydroxy-cyclohexancarbonsaeure |
