Introduction：Basic information about CAS 624722-10-7|2-hydroxy-2-(2-hydroxynaphthalen-1-yl)acetic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-hydroxy-2-(2-hydroxynaphthalen-1-yl)acetic acid |
|---|
| CAS Number | 624722-10-7 | Molecular Weight | 218.20500 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C12H10O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2-hydroxy-2-(2-hydroxynaphthalen-1-yl)acetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C12H10O4 |
|---|
| Molecular Weight | 218.20500 |
|---|
| Exact Mass | 218.05800 |
|---|
| PSA | 77.76000 |
|---|
| LogP | 1.66340 |
|---|
| InChIKey | KIJIBKVYISSOOB-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)C(O)c1c(O)ccc2ccccc12 |
|---|
Safety Information
Customs
| HS Code | 2918199090 |
|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| hydroxyhydroxynaphthylaceticacid |
