Introduction:Basic information about CAS 24300-91-2|2,7-di(tert-butyl)pyrene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,7-di(tert-butyl)pyrene |
|---|
| CAS Number | 24300-91-2 | Molecular Weight | 314.463 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 448.0±15.0 °C at 760 mmHg |
|---|
| Molecular Formula | C24H26 | Melting Point | 209 °C |
|---|
| MSDS | / | Flash Point | 222.4±14.5 °C |
|---|
Names
| Name | 2,7-ditert-butylpyrene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 448.0±15.0 °C at 760 mmHg |
|---|
| Melting Point | 209 °C |
|---|
| Molecular Formula | C24H26 |
|---|
| Molecular Weight | 314.463 |
|---|
| Flash Point | 222.4±14.5 °C |
|---|
| Exact Mass | 314.203461 |
|---|
| LogP | 8.55 |
|---|
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.662 |
|---|
| InChIKey | SKZSSCAGJZEXEA-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)c1cc2ccc3cc(C(C)(C)C)cc4ccc(c1)c2c34 |
|---|
Safety Information
Customs
| HS Code | 2902909090 |
|---|
| Summary | 2902909090 other aromatic hydrocarbons。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:2.0%。General tariff:30.0% |
|---|
Synonyms
| 2,7-di-tert-butyl-pyrene |
| 2,7-di(tert-butyl)pyrene |
| 2,7-di-t-butylpyrene |
| 2,7-Di-tert-butylpyrene |
| 2,7-Di-tert-butyl-pyren |
| Pyrene, 2,7-bis(1,1-dimethylethyl)- |
| 2,9-di-tert-butylpyrene |
| 2,7-Bis(2-methyl-2-propanyl)pyrene |