Introduction:Basic information about CAS 17070-56-3|3,4-Dihydronaphthalene-2-sulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,4-Dihydronaphthalene-2-sulfonyl chloride |
|---|
| CAS Number | 17070-56-3 | Molecular Weight | 228.69500 |
|---|
| Density | 1.41g/cm3 | Boiling Point | 359.1ºC at 760mmHg |
|---|
| Molecular Formula | C10H9ClO2S | Melting Point | / |
|---|
| MSDS | USA | Flash Point | 171ºC |
|---|
Names
| Name | 3,4-Dihydronaphthalene-2-sulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.41g/cm3 |
|---|
| Boiling Point | 359.1ºC at 760mmHg |
|---|
| Molecular Formula | C10H9ClO2S |
|---|
| Molecular Weight | 228.69500 |
|---|
| Flash Point | 171ºC |
|---|
| Exact Mass | 228.00100 |
|---|
| PSA | 42.52000 |
|---|
| LogP | 3.62310 |
|---|
| Vapour Pressure | 5.05E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.619 |
|---|
| InChIKey | XFOWQBUKLCPMED-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(Cl)C1=Cc2ccccc2CC1 |
|---|
Synonyms
| 1,2-Dihydro-naphthalin-3-sulfonsaeurechlorid |