Introduction：Basic information about CAS 320-29-6|4-Bromo-1,2-bis(trifluoromethyl)benzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Bromo-1,2-bis(trifluoromethyl)benzene |
|---|
| CAS Number | 320-29-6 | Molecular Weight | 293.004 |
|---|
| Density | 1.7±0.1 g/cm3 | Boiling Point | 181.6±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H3BrF6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 63.7±25.9 °C |
|---|
Names
| Name | 4-Bromo-1,2-bis(trifluoromethyl)benzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.7±0.1 g/cm3 |
|---|
| Boiling Point | 181.6±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H3BrF6 |
|---|
| Molecular Weight | 293.004 |
|---|
| Flash Point | 63.7±25.9 °C |
|---|
| Exact Mass | 291.932220 |
|---|
| LogP | 3.98 |
|---|
| Vapour Pressure | 1.1±0.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.422 |
|---|
| InChIKey | SVWLLRHUNXRVOS-UHFFFAOYSA-N |
|---|
| SMILES | FC(F)(F)c1ccc(Br)cc1C(F)(F)F |
|---|
Synonyms
| 4-Brom-1,2-bis-trifluormethyl-benzol |
| 1-bromo-4,4,4-triphenylbutan |
| Benzene, 4-bromo-1,2-bis(trifluoromethyl)- |
| 4-bromo-1,2-bis-trifluoromethyl-benzene |
| 4-Brom-1,1,1-triphenyl-butan |
| 5-bromo-2-trifluoromethylbenzotrifluoride |
| 4-Bromo-1,2-bis(trifluoromethyl)benzene |
| Benzene,1,1',1''-(4-bromobutylidyne)tris |
