Introduction：Basic information about CAS 946159-38-2|1-Benzyl-3-(4-methoxyphenyl)-3-piperidinol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-Benzyl-3-(4-methoxyphenyl)-3-piperidinol |
|---|
| CAS Number | 946159-38-2 | Molecular Weight | 297.391 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 441.1±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C19H23NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 220.6±28.7 °C |
|---|
Names
| Name | 1-benzyl-3-(4-methoxyphenyl)piperidin-3-ol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 441.1±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C19H23NO2 |
|---|
| Molecular Weight | 297.391 |
|---|
| Flash Point | 220.6±28.7 °C |
|---|
| Exact Mass | 297.172882 |
|---|
| PSA | 32.70000 |
|---|
| LogP | 3.02 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.597 |
|---|
| InChIKey | CNIBEWABPVGSSN-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(C2(O)CCCN(Cc3ccccc3)C2)cc1 |
|---|
Synonyms
| 1-benzyl-3-(4-methoxy-phenyl)-piperidin-3-ol |
| 1-Benzyl-3-(4-methoxyphenyl)-3-piperidinol |
| 3-Piperidinol, 3-(4-methoxyphenyl)-1-(phenylmethyl)- |
| 3-(4-methoxyphenyl)-1-(phenylmethyl)piperidin-3-ol |
| 3-(4-methoxyphenyl)-1-benzyl-3-piperidinol |
| 3-(4-methoxyphenyl)-1-(phenylmethyl)-3-piperidinol |
