Introduction:Basic information about CAS 1028206-56-5|Chloro(2-dicyclohexylphosphino-2',4',6'-triisopropyl-1,1'-bi, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Chloro(2-dicyclohexylphosphino-2',4',6'-triisopropyl-1,1'-biphenyl)[2-(2-aminoethyl)phenyl]palladium(II) |
|---|
| CAS Number | 1028206-56-5 | Molecular Weight | 738.761 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C41H59ClNPPd | Melting Point | 205-210℃ |
|---|
| MSDS | USA | Flash Point | / |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | [2-(2-Aminoethyl)phenyl](chloro)palladium-dicyclohexyl(2',4',6' -triisopropyl-2-biphenylyl)phosphine (1:1) |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 205-210℃ |
|---|
| Molecular Formula | C41H59ClNPPd |
|---|
| Molecular Weight | 738.761 |
|---|
| Exact Mass | 737.310852 |
|---|
| PSA | 39.61000 |
|---|
| LogP | 9.18870 |
|---|
| InChIKey | NMMPMZWIIQCZBA-UHFFFAOYSA-M |
|---|
| SMILES | CC(C)c1cc(C(C)C)c(-c2ccccc2P(C2CCCCC2)C2CCCCC2)c(C(C)C)c1.Cl[Pd+].NCCc1[c-]cccc1 |
|---|
| Storage condition | 2-8℃ |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335-H412 |
|---|
| Precautionary Statements | P261-P273-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi |
|---|
| Risk Phrases | 36/37/38-52/53 |
|---|
| Safety Phrases | 26-61 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| X-Phos pre-catalyst |
| N-(p-Biphenylmethyl)-atropinium bromide |
| 8-(p-Phenylbenzyl)atropinium bromide |
| Chloro(2-dicyclohexylphosphino-2',4,6'-tri-i-propyl-1,1'-biphenyl)[2-(2-aminoethyl)phenyl] palladium(II) methyl-t-butylether adduct |
| Xenytropium bromide |
| [2-(2-Aminoethyl)phenyl](chloro)palladium - dicyclohexyl(2',4',6'-triisopropyl-2-biphenylyl)phosphine (1:1) |
| Xenytropii bromidum [INN-Latin] |
| Palladium, [2-(2-aminoethyl)phenyl]chloro-, compd. with dicyclohexyl[2',4',6'-tris(1-methylethyl)[1,1'-biphenyl]-2-yl]phosphine (1:1) |
| Xenytropinium |
| XPhos palladacycle |
| chloro(2-dicyclohexylphosphino-2',4',6'-triisopropyl-1,1'-biphenyl)[2-(2'-amino-1,1'-biphenyl)]palladium(II) |
| Xenytropiumbromid |
| X-Phos biphenyl precatalyst |
| Bromure de xenytropium [INN-French] |
| Gastropin |
| Dendrepar |
| Bromuro de xenitropio [INN-Spanish] |
| Gastripon |
| Chloro(2-dicyclohexylphosphino-2',4',6'-triisopropyl-1,1'-biphenyl)[2-(2-aminoethyl)phenyl]palladium(II) |