Introduction:Basic information about CAS 948594-95-4|(1R,2R,4R)-6-benzyl-2-methoxy-2,4-dimethyl-8-(2-methylpropyl)bicyclo[2.2.2]oc, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (1R,2R,4R)-6-benzyl-2-methoxy-2,4-dimethyl-8-(2-methylpropyl)bicyclo[2.2.2]octa-5,7-diene |
|---|
| CAS Number | 948594-95-4 | Molecular Weight | 310.47300 |
|---|
| Density | 1g/cm3 | Boiling Point | 392.1ºC at 760 mmHg |
|---|
| Molecular Formula | C22H30O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 189.2ºC |
|---|
Names
| Name | (1R,2R,4R)-6-benzyl-2-methoxy-2,4-dimethyl-8-(2-methylpropyl)bicyclo[2.2.2]octa-5,7-diene |
|---|
Chemical & Physical Properties
| Density | 1g/cm3 |
|---|
| Boiling Point | 392.1ºC at 760 mmHg |
|---|
| Molecular Formula | C22H30O |
|---|
| Molecular Weight | 310.47300 |
|---|
| Flash Point | 189.2ºC |
|---|
| Exact Mass | 310.23000 |
|---|
| PSA | 9.23000 |
|---|
| LogP | 5.57290 |
|---|
| Index of Refraction | n20/D 1.5205 |
|---|
| InChIKey | ACWLDJOHMGJACE-BHIFYINESA-N |
|---|
| SMILES | COC1(C)CC2(C)C=C(Cc3ccccc3)C1C=C2CC(C)C |
|---|