Introduction：Basic information about CAS 419565-61-0|methyl 3-(5-chlorothiophen-2-yl)-2,2-dimethylpropanoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | methyl 3-(5-chlorothiophen-2-yl)-2,2-dimethylpropanoate |
|---|
| CAS Number | 419565-61-0 | Molecular Weight | 232.72700 |
|---|
| Density | 1.204 | Boiling Point | 276ºC |
|---|
| Molecular Formula | C10H13ClO2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 121ºC |
|---|
Names
| Name | methyl 3-(5-chlorothiophen-2-yl)-2,2-dimethylpropanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.204 |
|---|
| Boiling Point | 276ºC |
|---|
| Molecular Formula | C10H13ClO2S |
|---|
| Molecular Weight | 232.72700 |
|---|
| Flash Point | 121ºC |
|---|
| Exact Mass | 232.03200 |
|---|
| PSA | 54.54000 |
|---|
| LogP | 3.14320 |
|---|
| Index of Refraction | 1.526 |
|---|
| InChIKey | XIBASKAIHVRCMD-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)C(C)(C)Cc1ccc(Cl)s1 |
|---|
Synonyms
| 3-(5-chloro-thiophen-2-yl)-2,2-dimethyl-propionic acid methyl ester |
| 2-Thiophenepropanoicacid,5-chloro-a,a-dimethyl-,methyl ester |
