Introduction：Basic information about CAS 101-65-5|diphenyl (methylenedi-4,1-phenylene)-dicarbamate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | diphenyl (methylenedi-4,1-phenylene)-dicarbamate |
|---|
| CAS Number | 101-65-5 | Molecular Weight | 438.47500 |
|---|
| Density | 1.294g/cm3 | Boiling Point | 570.7ºC at 760mmHg |
|---|
| Molecular Formula | C27H22N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 298.9ºC |
|---|
Names
| Name | phenyl N-[4-[[4-(phenoxycarbonylamino)phenyl]methyl]phenyl]carbamate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.294g/cm3 |
|---|
| Boiling Point | 570.7ºC at 760mmHg |
|---|
| Molecular Formula | C27H22N2O4 |
|---|
| Molecular Weight | 438.47500 |
|---|
| Flash Point | 298.9ºC |
|---|
| Exact Mass | 438.15800 |
|---|
| PSA | 76.66000 |
|---|
| LogP | 6.64520 |
|---|
| Vapour Pressure | 4.93E-13mmHg at 25°C |
|---|
| Index of Refraction | 1.675 |
|---|
| InChIKey | LKYATCXVAUHHMS-UHFFFAOYSA-N |
|---|
| SMILES | O=C(Nc1ccc(Cc2ccc(NC(=O)Oc3ccccc3)cc2)cc1)Oc1ccccc1 |
|---|
Synonyms
| N,N'-(4,4'-Methandiyl-di-phenyl)-bis-carbamidsaeure-diphenylester |
| EINECS 202-963-4 |
| 4,4'-Bis-<phenoxy-carbonylamino>-diphenylmethan |
| diphenyl(methanediyldibenzene-4,1-diyl)biscarbamate |
| Bis-(4-phenoxycarbonylamino-phenyl)-methan |
| Diphenyl 4,4'-methylenebis(phenylcarbamate) |
| N,N'-(4,4'-methanediyl-di-phenyl)-bis-carbamic acid diphenyl ester |
| diphenyl (methylenedi-4,1-phenylene)-dicarbamate |
