Introduction：Basic information about CAS 6694-75-3|4-(chloromethyl)-2-nitrophenol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(chloromethyl)-2-nitrophenol |
|---|
| CAS Number | 6694-75-3 | Molecular Weight | 187.58000 |
|---|
| Density | 1.472g/cm3 | Boiling Point | 313ºC at 760 mmHg |
|---|
| Molecular Formula | C7H6ClNO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 143.1ºC |
|---|
Names
| Name | 4-(chloromethyl)-2-nitrophenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.472g/cm3 |
|---|
| Boiling Point | 313ºC at 760 mmHg |
|---|
| Molecular Formula | C7H6ClNO3 |
|---|
| Molecular Weight | 187.58000 |
|---|
| Flash Point | 143.1ºC |
|---|
| Exact Mass | 187.00400 |
|---|
| PSA | 66.05000 |
|---|
| LogP | 2.56240 |
|---|
| Index of Refraction | 1.614 |
|---|
| InChIKey | LCYZFNFGPVNDGS-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1cc(CCl)ccc1O |
|---|
Safety Information
Customs
| HS Code | 2908999090 |
|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| 4-chloromethyl-nitrophenol |
| 4-chloromethyl-2-nitro-phenol |
| 4-hydroxy-3-nitro-benzyl chloride |
| 11-Chlor-3-nitro-4-oxy-1-methyl-benzol |
| 3-Nitro-4-hydroxybenzyl chloride |
| 41-Chlor-2-nitro-p-kresol |
