Introduction：Basic information about CAS 74317-45-6|3-hydroxyamino-1-methyl-5H-pyrido(4,3-b)indole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-hydroxyamino-1-methyl-5H-pyrido(4,3-b)indole |
|---|
| CAS Number | 74317-45-6 | Molecular Weight | 213.23500 |
|---|
| Density | 1.461g/cm3 | Boiling Point | 491.6ºC at 760 mmHg |
|---|
| Molecular Formula | C12H11N3O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 251.1ºC |
|---|
Names
| Name | N-(1-methyl-5H-pyrido[4,3-b]indol-3-yl)hydroxylamine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.461g/cm3 |
|---|
| Boiling Point | 491.6ºC at 760 mmHg |
|---|
| Molecular Formula | C12H11N3O |
|---|
| Molecular Weight | 213.23500 |
|---|
| Flash Point | 251.1ºC |
|---|
| Exact Mass | 213.09000 |
|---|
| PSA | 60.94000 |
|---|
| LogP | 2.89860 |
|---|
| Index of Refraction | 1.86 |
|---|
| InChIKey | VWXMRYZUBOAGIS-UHFFFAOYSA-N |
|---|
| SMILES | Cc1nc(NO)cc2[nH]c3ccccc3c12 |
|---|
Synonyms
| Trp-P-2 N-hydroxylated derivative |
| Hydroxy-TRP-P-2 |
