Introduction：Basic information about CAS 412928-75-7|flucetosulfuron, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | flucetosulfuron |
|---|
| CAS Number | 412928-75-7 | Molecular Weight | 487.45900 |
|---|
| Density | 1.417g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C18H22FN5O8S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | flucetosulfuron |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.417g/cm3 |
|---|
| Molecular Formula | C18H22FN5O8S |
|---|
| Molecular Weight | 487.45900 |
|---|
| Exact Mass | 487.11700 |
|---|
| PSA | 179.80000 |
|---|
| LogP | 2.47320 |
|---|
| Index of Refraction | 1.552 |
|---|
| InChIKey | FICWGWVVIRLNRB-UHFFFAOYSA-N |
|---|
| SMILES | COCC(=O)OC(c1ncccc1S(=O)(=O)NC(=O)Nc1nc(OC)cc(OC)n1)C(C)F |
|---|
| Storage condition | -20°C |
|---|
Synonyms
| 1-[3-[[[[(4,6-dimethoxy-2-pyrimidinyl)amino]carbonyl]amino]sulfonyl]-2-pyridinyl]-2-fluoropropyl 2-methoxyacetate |
| 1RS,2RS)-1-{3-[(4,6-dimethoxypyrimidin-2-ylcarbamoyl)sulfamoyl]-2-pyridyl}-2-fluoropropyl methoxyacetate |
| Flucetosulfuron [ISO:BSI] |
| (1RS,2SR |
| Flucetosulfuron |
| [1-[3-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]pyridin-2-yl]-2-fluoropropyl] 2-methoxyacetate |
| rac-(1R,2RS)-1-({3-[(4,6-dimethoxypyrimidin-2-yl)carbamoyl]sulfamoyl}pyridin-2-yl)-2-fluoropropyl methoxyacetate |
