Introduction：Basic information about CAS 52301-18-5|Tris(isopropenyloxy)(phenyl)silane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Tris(isopropenyloxy)(phenyl)silane |
|---|
| CAS Number | 52301-18-5 | Molecular Weight | 276.403 |
|---|
| Density | 1.0±0.1 g/cm3 | Boiling Point | 298.5±13.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H20O3Si | Melting Point | / |
|---|
| MSDS | / | Flash Point | 135.2±27.3 °C |
|---|
Names
| Name | phenyl-tris(prop-1-en-2-yloxy)silane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.0±0.1 g/cm3 |
|---|
| Boiling Point | 298.5±13.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H20O3Si |
|---|
| Molecular Weight | 276.403 |
|---|
| Flash Point | 135.2±27.3 °C |
|---|
| Exact Mass | 276.118164 |
|---|
| PSA | 27.69000 |
|---|
| LogP | 7.73 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.496 |
|---|
| InChIKey | XGIZTLFJCDBRDD-UHFFFAOYSA-N |
|---|
| SMILES | C=C(C)O[Si](OC(=C)C)(OC(=C)C)c1ccccc1 |
|---|
Safety Information
| Risk Phrases | 50/53 |
|---|
| Safety Phrases | 60-61 |
|---|
Synonyms
| Tris(isopropenyloxy)(phenyl)silane |
| 1UY1&O-SI-R&OY1&U1&OY1&U1 |
| [Tris[(1-methylethenyl)oxy]silyl]benzene |
| Silane,tris((1-methylethenyl)oxy)phenyl |
| phenyl[tris(prop-1-en-2-yloxy)]silane |
| Tris[(1-methylethenyl)oxy]phenylsilane |
| Benzene, [tris[(1-methylethenyl)oxy]silyl]- |
