Introduction：Basic information about CAS 2300-16-5|3,6-dinitrophthalic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,6-dinitrophthalic acid |
|---|
| CAS Number | 2300-16-5 | Molecular Weight | 256.12600 |
|---|
| Density | 1.853g/cm3 | Boiling Point | 495.2ºC at 760mmHg |
|---|
| Molecular Formula | C8H4N2O8 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 219.2ºC |
|---|
Names
| Name | 3,6-dinitrophthalic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.853g/cm3 |
|---|
| Boiling Point | 495.2ºC at 760mmHg |
|---|
| Molecular Formula | C8H4N2O8 |
|---|
| Molecular Weight | 256.12600 |
|---|
| Flash Point | 219.2ºC |
|---|
| Exact Mass | 255.99700 |
|---|
| PSA | 166.24000 |
|---|
| LogP | 1.94580 |
|---|
| Vapour Pressure | 1.27E-10mmHg at 25°C |
|---|
| Index of Refraction | 1.696 |
|---|
| InChIKey | MZDSOZBFTCRKNT-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1c([N+](=O)[O-])ccc([N+](=O)[O-])c1C(=O)O |
|---|
Safety Information
Customs
| HS Code | 2917399090 |
|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 3,6-dinitrobenzene-1,2-dioic acid |
| EINECS 218-950-1 |
| 3,6-dinitro-phthalic acid |
| 3,6-Dinitro-phthalsaeure |
