Introduction：Basic information about CAS 74472-48-3|2,2',3,4,4',6,6'-Heptachlorobiphenyl, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,2',3,4,4',6,6'-Heptachlorobiphenyl |
|---|
| CAS Number | 74472-48-3 | Molecular Weight | 395.32300 |
|---|
| Density | 1.6580 (rough estimate) | Boiling Point | 479.43°C (rough estimate) |
|---|
| Molecular Formula | C12H3Cl7 | Melting Point | 131.31°C (estimate) |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2,2',3,4,4',6,6'-Heptachlorobiphenyl |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6580 (rough estimate) |
|---|
| Boiling Point | 479.43°C (rough estimate) |
|---|
| Melting Point | 131.31°C (estimate) |
|---|
| Molecular Formula | C12H3Cl7 |
|---|
| Molecular Weight | 395.32300 |
|---|
| Exact Mass | 391.80500 |
|---|
| LogP | 7.92740 |
|---|
| Index of Refraction | 1.6330 (rough estimate) |
|---|
| InChIKey | OBIUJJSQKPGKME-UHFFFAOYSA-N |
|---|
| SMILES | Clc1cc(Cl)c(-c2c(Cl)cc(Cl)c(Cl)c2Cl)c(Cl)c1 |
|---|
Synonyms
| 1,2,3,5-tetrachloro-4-(2,4,6-trichlorophenyl)benzene |
