Introduction：Basic information about CAS 37680-69-6|3,3',4-PCB, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,3',4-PCB |
|---|
| CAS Number | 37680-69-6 | Molecular Weight | 257.543 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 353.3±27.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H7Cl3 | Melting Point | 87°C |
|---|
| MSDS | / | Flash Point | 244.8±19.3 °C |
|---|
Names
| Name | 3,3',4-Trichlorobiphenyl |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 353.3±27.0 °C at 760 mmHg |
|---|
| Melting Point | 87°C |
|---|
| Molecular Formula | C12H7Cl3 |
|---|
| Molecular Weight | 257.543 |
|---|
| Flash Point | 244.8±19.3 °C |
|---|
| Exact Mass | 255.961334 |
|---|
| LogP | 5.55 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.604 |
|---|
| InChIKey | JHBVPKZLIBDTJR-UHFFFAOYSA-N |
|---|
| SMILES | Clc1cccc(-c2ccc(Cl)c(Cl)c2)c1 |
|---|
| Storage condition | -20°C |
|---|
Synonyms
| 1,1'-Biphenyl, 3,3',4-trichloro |
| 3,4,3'-Trichlorobiphenyl |
| 1,1'-Biphenyl, 3,3',4-trichloro- |
| 1,2-dichloro-4-(3-chlorophenyl)benzene |
| 3,3',4-Trichloro-1,1'-biphenyl |
| 3,3',4-PCB |
| 3,3',4-Trichlorobiphenyl |
