Introduction:Basic information about CAS 6641-64-1|3,4-Dichloro-6-nitroaniline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,4-Dichloro-6-nitroaniline |
|---|
| CAS Number | 6641-64-1 | Molecular Weight | 207.014 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | 347.1±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C6H4Cl2N2O2 | Melting Point | 177-179 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 163.7±26.5 °C |
|---|
| Symbol | GHS06, GHS08, GHS09 | Signal Word | Danger |
|---|
Names
| Name | 4,5-Dichloro-2-nitroaniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Boiling Point | 347.1±37.0 °C at 760 mmHg |
|---|
| Melting Point | 177-179 °C(lit.) |
|---|
| Molecular Formula | C6H4Cl2N2O2 |
|---|
| Molecular Weight | 207.014 |
|---|
| Flash Point | 163.7±26.5 °C |
|---|
| Exact Mass | 205.964981 |
|---|
| PSA | 71.84000 |
|---|
| LogP | 3.55 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.656 |
|---|
| InChIKey | FSGTULQLEVAYRS-UHFFFAOYSA-N |
|---|
| SMILES | Nc1cc(Cl)c(Cl)cc1[N+](=O)[O-] |
|---|
Safety Information
| Symbol | GHS06, GHS08, GHS09 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H300 + H310 + H330-H373-H411 |
|---|
| Precautionary Statements | P260-P280-P301 + P310 + P330-P302 + P352 + P310-P304 + P340 + P310-P403 + P233 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xn:Harmful; |
|---|
| Risk Phrases | R20/21/22;R36/37/38 |
|---|
| Safety Phrases | S26-S37/39-S36/37/39-S22 |
|---|
| RIDADR | 2811 |
|---|
| WGK Germany | 3 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 6.1(b) |
|---|
| HS Code | 2921420090 |
|---|
Customs
| HS Code | 2921420090 |
|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 4,5-dichloro-2-nitro-aniline |
| 2-nitro-4,5-dichloroaniline |
| EINECS 229-657-3 |
| Benzenamine, 4,5-dichloro-2-nitro- |
| 4,5-dichloro-2-nitrophenylamine |
| MFCD00007770 |
| 4,5-dichlor-2-nitroanilin |
| Benzenamine,4,5-dichloro-2-nitro |
| 3,4-Dichloro-6-nitroaniline |
| 4,5-Dichloro-2-nitroaniline |