Introduction：Basic information about CAS 5256-79-1|Octaphenylsilsesquioxane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Octaphenylsilsesquioxane |
|---|
| CAS Number | 5256-79-1 | Molecular Weight | 1033.508 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 41.5ºC at 760mmHg |
|---|
| Molecular Formula | C48H40O12Si8 | Melting Point | >350ºC |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
Names
| Name | Octaphenylsilsesquioxane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 41.5ºC at 760mmHg |
|---|
| Melting Point | >350ºC |
|---|
| Molecular Formula | C48H40O12Si8 |
|---|
| Molecular Weight | 1033.508 |
|---|
| Exact Mass | 1032.067383 |
|---|
| PSA | 110.76000 |
|---|
| LogP | 3.02240 |
|---|
| Index of Refraction | 1.659 |
|---|
| InChIKey | KBXJHRABGYYAFC-UHFFFAOYSA-N |
|---|
| SMILES | c1ccc([Si]23O[Si]4(c5ccccc5)O[Si]5(c6ccccc6)O[Si](c6ccccc6)(O2)O[Si]2(c6ccccc6)O[Si](c6ccccc6)(O3)O[Si](c3ccccc3)(O4)O[Si](c3ccccc3)(O5)O2)cc1 |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|
| Hazard Codes | Xi |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| Octaphenylsilsesquioxane |
| Hydrogen-POSS |
| octaphenyl-silsesquioxane |
| 1,3,5,7,9,11,13,15-Octaphenylpentacyclo[9.5.1.1.1.1]octasiloxane |
| 1,3,5,7,9,11,13,15-OCTAPHENYLPENTACYCLO-OCTASILOXANE |
| Pentacyclo[9.5.1.1.1.1]octasiloxane, 1,3,5,7,9,11,13,15-octaphenyl- |
| octaphenylpentacyclosilsesquioxane |
| pss-octaphenyl substituted |
| octaphenyloctasilsesquioxane |
| Poly(Phenyl Silsesquioxane) |
| Perphenyloctasilsesquioxane |
| phenyl8Si8O12 |
| Phenyl-POSS |
| Nitrophenyl-POSS |
| 1,3,5,7,9,11,13,15-Octaphenylpentacyclo[9.5.1.13,9.15,15.17,13]octasiloxane |
| MFCD00308870 |
| OCTAPHENYL-T8-SILSESQUIOXANE |
| Aminophenyl-POSS |
