Introduction：Basic information about CAS 22134-75-4|3,5-dichlorosulfanilamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,5-dichlorosulfanilamide |
|---|
| CAS Number | 22134-75-4 | Molecular Weight | 241.09500 |
|---|
| Density | 1.667g/cm3 | Boiling Point | 427.5ºC at 760mmHg |
|---|
| Molecular Formula | C6H6Cl2N2O2S | Melting Point | 206-208°C |
|---|
| MSDS | / | Flash Point | 212.4ºC |
|---|
Names
| Name | 4-amino-3,5-dichlorobenzenesulfonamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.667g/cm3 |
|---|
| Boiling Point | 427.5ºC at 760mmHg |
|---|
| Melting Point | 206-208°C |
|---|
| Molecular Formula | C6H6Cl2N2O2S |
|---|
| Molecular Weight | 241.09500 |
|---|
| Flash Point | 212.4ºC |
|---|
| Exact Mass | 239.95300 |
|---|
| PSA | 94.56000 |
|---|
| LogP | 3.58530 |
|---|
| Vapour Pressure | 1.63E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.645 |
|---|
| InChIKey | DVZMRTJKNJKEGV-UHFFFAOYSA-N |
|---|
| SMILES | Nc1c(Cl)cc(S(N)(=O)=O)cc1Cl |
|---|
Safety Information
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| HS Code | 2935009090 |
|---|
Customs
| HS Code | 2935009090 |
|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|---|
Synonyms
| 4-Amino-3,5-dichlor-benzolsulfonsaeure-amid |
| 3.5-Dichlor-4-amino-benzolsulfonamid-(1) |
| EINECS 244-799-6 |
| Sulfanilamide,5-dichloro |
| 3,5-Dichloro-4-aminobenzenesulfonamide |
| 4-amino-3,5-dichloro-benzenesulfonic acid amide |
| 4-amino-3,5-dichloro-benzenesulfonamide |
| 3,5-Dichlorosulphanilamide |
| 3,5-Dichlorosulfanilamide |
| Benzenesulfonamide,4-amino-3,5-dichloro |
| MFCD00014784 |
