Introduction:Basic information about CAS 69416-61-1|d-(-)-a-4-hydroxyphenylglycine dane salt methyl potassium, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | d-(-)-a-4-hydroxyphenylglycine dane salt methyl potassium |
|---|
| CAS Number | 69416-61-1 | Molecular Weight | 303.35200 |
|---|
| Density | / | Boiling Point | 476.6ºC at 760 mmHg |
|---|
| Molecular Formula | C13H14KNO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 242.1ºC |
|---|
Names
| Name | d-(-)-a-4-hydroxyphenylglycine dane salt methyl potassium |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 476.6ºC at 760 mmHg |
|---|
| Molecular Formula | C13H14KNO5 |
|---|
| Molecular Weight | 303.35200 |
|---|
| Flash Point | 242.1ºC |
|---|
| Exact Mass | 303.05100 |
|---|
| PSA | 98.69000 |
|---|
| LogP | 0.24050 |
|---|
| InChIKey | HFDVONAPNRXRSV-CFYXSCKTSA-M |
|---|
| SMILES | COC(=O)C=C(C)NC(C(=O)[O-])c1ccc(O)cc1.[K+] |
|---|
Safety Information
Synonyms
| D-p-HydroxyphenylglycinemethylpatassiumDane |
| D-(-)-p-hydroxyphenylglycine dane salt |
| D-(-)-4-HYDROXYPHENYLGLYCINEDANESALTMETHYLPOTASSIUM |
| D-(4-Hydroxyphenyl)-glycine dane salt potassium methyl |
| EINECS 273-992-8 |
| MFCD00038571 |
| Potassium 2-(4-hydroxyphenyl)-2-((4-methoxy-4-oxobut-2-en-2-yl)amino)acetate |
| Potassium salt of D-para hydroxy penylglycine |
| D-(-)-4-Hydroxyphenylglycine Dane Salt (K,M) |
| Potassium (R)-(4-hydroxyphenyl)((3-methoxy-1-methyl-3-oxoprop-1-enyl)amino)acetate |
| Hydroxyphenylglycine dane salt methyl potassium |