Introduction：Basic information about CAS 690632-22-5|1-[(2,4,6-trimethylphenyl)methyl]-1,4-diazepane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-[(2,4,6-trimethylphenyl)methyl]-1,4-diazepane |
|---|
| CAS Number | 690632-22-5 | Molecular Weight | 232.36400 |
|---|
| Density | 0.974g/cm3 | Boiling Point | 117ºC |
|---|
| Molecular Formula | C15H24N2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 127.7ºC |
|---|
Names
| Name | 1-[(2,4,6-trimethylphenyl)methyl]-1,4-diazepane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.974g/cm3 |
|---|
| Boiling Point | 117ºC |
|---|
| Molecular Formula | C15H24N2 |
|---|
| Molecular Weight | 232.36400 |
|---|
| Flash Point | 127.7ºC |
|---|
| Exact Mass | 232.19400 |
|---|
| PSA | 15.27000 |
|---|
| LogP | 2.67380 |
|---|
| Index of Refraction | 1.529 |
|---|
| InChIKey | FNKQURSLYXVLGQ-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(C)c(CN2CCCNCC2)c(C)c1 |
|---|
Synonyms
| 1-(mesitylmethyl)-1,4-diazepane |
