Introduction:Basic information about CAS 104224-50-2|5,5,8,8-Tetramethyl-5,6,7,8-tetrahydro-2-naphthalenecarbonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5,5,8,8-Tetramethyl-5,6,7,8-tetrahydro-2-naphthalenecarbonyl chloride |
|---|
| CAS Number | 104224-50-2 | Molecular Weight | 250.76400 |
|---|
| Density | 1.047g/cm3 | Boiling Point | 326.7ºC at 760mmHg |
|---|
| Molecular Formula | C15H19ClO | Melting Point | / |
|---|
| MSDS | / | Flash Point | 152.4ºC |
|---|
Names
| Name | 5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carbonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.047g/cm3 |
|---|
| Boiling Point | 326.7ºC at 760mmHg |
|---|
| Molecular Formula | C15H19ClO |
|---|
| Molecular Weight | 250.76400 |
|---|
| Flash Point | 152.4ºC |
|---|
| Exact Mass | 250.11200 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 4.41460 |
|---|
| Vapour Pressure | 0.000212mmHg at 25°C |
|---|
| Index of Refraction | 1.512 |
|---|
| InChIKey | CPWIUCQCJRWWTH-UHFFFAOYSA-N |
|---|
| SMILES | CC1(C)CCC(C)(C)c2cc(C(=O)Cl)ccc21 |
|---|
Safety Information
| Hazard Codes | C:Corrosive |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | S26-S36/37/39-S45 |
|---|
| HS Code | 2916399090 |
|---|
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 5,5,8,8-tetramethyl-5,6,7,8-tetrahydronaphthalene-2-carbonyl chloride |
| 5,5,8,8-TETRAMETHYL-5,6,7,8-TETRAHYDRO-2-NAPHTHALENECARBONYL CHLORIDE |
| 2-Naphthalenecarbonylchloride,5,6,7,8-tetrahydro-5,5,8,8-tetramethyl |
| 5,6,7,8-tetrahydro-5,5,8,8-tetramethylnaphthalene-2-carbonyl chloride |
| 5,6,7,8-tetrahydro-5,5,8,8-tetramethyl-2-naphtholyl chloride |
| 5,6,7,8-tetrahydro-5,5,8,8-tetramethyl-2-naphthoyl chloride |