Introduction：Basic information about CAS 50606-97-8|4-octylbenzoyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-octylbenzoyl chloride |
|---|
| CAS Number | 50606-97-8 | Molecular Weight | 252.78000 |
|---|
| Density | 1.02 g/cm3 | Boiling Point | 337.5ºC at 760 mmHg ;193ºC (10 mmHg) |
|---|
| Molecular Formula | C15H21ClO | Melting Point | 0ºC |
|---|
| MSDS | / | Flash Point | 158.6ºC |
|---|
Names
| Name | 4-octylbenzoyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.02 g/cm3 |
|---|
| Boiling Point | 337.5ºC at 760 mmHg ;193ºC (10 mmHg) |
|---|
| Melting Point | 0ºC |
|---|
| Molecular Formula | C15H21ClO |
|---|
| Molecular Weight | 252.78000 |
|---|
| Flash Point | 158.6ºC |
|---|
| Exact Mass | 252.12800 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 4.96860 |
|---|
| Index of Refraction | 1.5175-1.5195 |
|---|
| InChIKey | NEKGDYGTJYCIRI-UHFFFAOYSA-N |
|---|
| SMILES | CCCCCCCCc1ccc(C(=O)Cl)cc1 |
|---|
Safety Information
| Hazard Codes | C: Corrosive; |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | 45-36/37/39-26 |
|---|
| HS Code | 2916399090 |
|---|
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 4-n-octylbenzoyl chloride |
| p-n-Octylbenzoic acid chloride |
| EINECS 256-649-7 |
| 4-Octyl-benzoylchlorid |
| 4-octyl-benzoyl chloride |
| Benzoyl chloride,4-octyl |
| 4-octylbenzoic acid chloride |
| 4-Octylbenzoyl chloride |
| p-n-octylbenzoyl chloride |
