Introduction:Basic information about CAS 235752-73-5|4-Nitrophenyl 2-acetamido-6-O-(2-acetamido-2-deoxy-β-D-glucopyranosyl)-2, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Nitrophenyl 2-acetamido-6-O-(2-acetamido-2-deoxy-β-D-glucopyranosyl)-2-deoxy-α-D-galactopyranoside |
|---|
| CAS Number | 235752-73-5 | Molecular Weight | 545.49400 |
|---|
| Density | 1.55g/cm3 | Boiling Point | 972.3ºC at 760 mmHg |
|---|
| Molecular Formula | C22H31N3O13 | Melting Point | 286ºC dec. |
|---|
| MSDS | / | Flash Point | 541.8ºC |
|---|
Names
| Name | 4-Nitrophenyl 2-acetamido-6-O-(2-acetamido-2-deoxy-β-D-glucopyranosyl)-2-deoxy-α-D-galactopyranoside |
|---|
Chemical & Physical Properties
| Density | 1.55g/cm3 |
|---|
| Boiling Point | 972.3ºC at 760 mmHg |
|---|
| Melting Point | 286ºC dec. |
|---|
| Molecular Formula | C22H31N3O13 |
|---|
| Molecular Weight | 545.49400 |
|---|
| Flash Point | 541.8ºC |
|---|
| Exact Mass | 545.18600 |
|---|
| PSA | 242.09000 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.63 |
|---|
| InChIKey | VQYVGLNPBRTHNR-NMEFWLLUSA-N |
|---|
| SMILES | CC(=O)NC1C(OCC2OC(Oc3ccc([N+](=O)[O-])cc3)C(NC(C)=O)C(O)C2O)OC(CO)C(O)C1O |
|---|