Introduction：Basic information about CAS 214475-53-3|4-(fmoc-hydrazino)-benzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(fmoc-hydrazino)-benzoic acid |
|---|
| CAS Number | 214475-53-3 | Molecular Weight | 374.38900 |
|---|
| Density | 1.363 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C22H18N2O4 | Melting Point | / |
|---|
| MSDS | USA | Flash Point | / |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 4-[2-(9H-fluoren-9-ylmethoxycarbonyl)hydrazinyl]benzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.363 g/cm3 |
|---|
| Molecular Formula | C22H18N2O4 |
|---|
| Molecular Weight | 374.38900 |
|---|
| Exact Mass | 374.12700 |
|---|
| PSA | 87.66000 |
|---|
| LogP | 4.71430 |
|---|
| InChIKey | MLVJMSRGLQCZDE-UHFFFAOYSA-N |
|---|
| SMILES | O=C(NNc1ccc(C(=O)O)cc1)OCC1c2ccccc2-c2ccccc21 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 29280000 |
|---|
Synonyms
| 4-(fmoc-hydrazinyl)benzoic acid |
| 4-(Fmoc-hydrazino)-benzoic acid |
| 4-(2-Fmoc-hydrazino)benzoic acid |
