Introduction：Basic information about CAS 270063-48-4|Boc-(S)-3-amino-4-(2,4-dichlorophenyl)butyric acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Boc-(S)-3-amino-4-(2,4-dichlorophenyl)butyric acid |
|---|
| CAS Number | 270063-48-4 | Molecular Weight | 348.222 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 483.8±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H19Cl2NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 246.4±28.7 °C |
|---|
Names
| Name | Boc-(S)-3-amino-4-(2,4-dichlorophenyl)butyric acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 483.8±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H19Cl2NO4 |
|---|
| Molecular Weight | 348.222 |
|---|
| Flash Point | 246.4±28.7 °C |
|---|
| Exact Mass | 347.069122 |
|---|
| PSA | 75.63000 |
|---|
| LogP | 4.24 |
|---|
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.554 |
|---|
| InChIKey | HGGWEUIYPYFHNX-NSHDSACASA-N |
|---|
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)O)Cc1ccc(Cl)cc1Cl |
|---|
Synonyms
| Pentanedioic acid, 3-amino-2-(2,4-dichlorophenyl)-, 1-(1,1-dimethylethyl) ester, (3S)- |
| (3S)-3-Amino-4-(2,4-dichlorophenyl)-5-[(2-methyl-2-propanyl)oxy]-5-oxopentanoic acid |
| Benzenebutanoic acid, 2,4-dichloro-β-[[(1,1-dimethylethoxy)carbonyl]amino]-, (βS)- |
| boc-(s)-3-amino-4-(2,4-dichloro-phenyl)-butyric acid |
| (3S)-4-(2,4-Dichlorophenyl)-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)butanoic acid |
| MFCD01861044 |
| Boc-L-β-Homo-2,4-CL2-Phe |
